C20H16F3IN4O5 — CID 72783529
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(1,3-oxazol-2-ylmethoxyiminomethyl)benzamide (PubChem CID 72783529) has the molecular formula C20H16F3IN4O5 and a molecular weight of 576.27 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(1,3-oxazol-2-ylmethoxyiminomethyl)benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(1,3-oxazol-2-ylmethoxyiminomethyl)benzamide |
|---|---|
| PubChem CID | 72783529 |
| Molecular Formula | C20H16F3IN4O5 |
| Molecular Weight | 576.27 g/mol |
| Exact Mass | 576.01 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(1,3-oxazol-2-ylmethoxyiminomethyl)benzamide |
| SMILES | O=C(NOCCO)c1cc(C=NOCc2ncco2)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C20H16F3IN4O5/c21-14-8-12(24)1-2-15(14)27-19-13(20(30)28-32-6-4-29)7-11(17(22)18(19)23)9-26-33-10-16-25-3-5-31-16/h1-3,5,7-9,27,29H,4,6,10H2,(H,28,30) |
| InChIKey | MWHJIERLRDUXOU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|