C17H13FIN3O4 — CID 25109796
6-(2-fluoro-4-iodoanilino)-5-(furan-2-carbonyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 25109796) has the molecular formula C17H13FIN3O4 and a molecular weight of 469.21 g/mol. Its IUPAC name is 6-(2-fluoro-4-iodoanilino)-5-(furan-2-carbonyl)-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-(2-fluoro-4-iodoanilino)-5-(furan-2-carbonyl)-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25109796 |
| Molecular Formula | C17H13FIN3O4 |
| Molecular Weight | 469.21 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | 6-(2-fluoro-4-iodoanilino)-5-(furan-2-carbonyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(Nc2ccc(I)cc2F)c(C(=O)c2ccco2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C17H13FIN3O4/c1-21-15(20-11-6-5-9(19)8-10(11)18)13(16(24)22(2)17(21)25)14(23)12-4-3-7-26-12/h3-8,20H,1-2H3 |
| InChIKey | CJUFXQZEYPNWQY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|