C21H15FIN5O4 — CID 154662818
2-(2-fluoro-4-iodoanilino)-1-methyl-4-(1-nitrosoindol-4-yl)oxy-6-oxopyridine-3-carboxamide (PubChem CID 154662818) has the molecular formula C21H15FIN5O4 and a molecular weight of 547.28 g/mol. Its IUPAC name is 2-(2-fluoro-4-iodoanilino)-1-methyl-4-(1-nitrosoindol-4-yl)oxy-6-oxopyridine-3-carboxamide.
| Compound Name | 2-(2-fluoro-4-iodoanilino)-1-methyl-4-(1-nitrosoindol-4-yl)oxy-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 154662818 |
| Molecular Formula | C21H15FIN5O4 |
| Molecular Weight | 547.28 g/mol |
| Exact Mass | 547.02 |
| IUPAC Name | 2-(2-fluoro-4-iodoanilino)-1-methyl-4-(1-nitrosoindol-4-yl)oxy-6-oxopyridine-3-carboxamide |
| SMILES | Cn1c(Nc2ccc(I)cc2F)c(C(N)=O)c(Oc2cccc3c2ccn3N=O)cc1=O |
| InChI | InChI=1S/C21H15FIN5O4/c1-27-18(29)10-17(32-16-4-2-3-15-12(16)7-8-28(15)26-31)19(20(24)30)21(27)25-14-6-5-11(23)9-13(14)22/h2-10,25H,1H3,(H2,24,30) |
| InChIKey | YJYBSOLRGZFEDV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|