C11H8ClNO2 — CID 115010192
(4-chlorofuro[2,3-f][1]benzofuran-8-yl)methanamine (PubChem CID 115010192) has the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. Its IUPAC name is (4-chlorofuro[2,3-f][1]benzofuran-8-yl)methanamine.
| Compound Name | (4-chlorofuro[2,3-f][1]benzofuran-8-yl)methanamine |
|---|---|
| PubChem CID | 115010192 |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | (4-chlorofuro[2,3-f][1]benzofuran-8-yl)methanamine |
| SMILES | NCc1c2ccoc2c(Cl)c2ccoc12 |
| InChI | InChI=1S/C11H8ClNO2/c12-9-7-2-4-14-10(7)8(5-13)6-1-3-15-11(6)9/h1-4H,5,13H2 |
| InChIKey | XBWLHADMHZETRA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |