C13H13NO3 — CID 117333887
2-(4-methoxyfuro[2,3-f][1]benzofuran-8-yl)ethanamine (PubChem CID 117333887) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-(4-methoxyfuro[2,3-f][1]benzofuran-8-yl)ethanamine.
| Compound Name | 2-(4-methoxyfuro[2,3-f][1]benzofuran-8-yl)ethanamine |
|---|---|
| PubChem CID | 117333887 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-(4-methoxyfuro[2,3-f][1]benzofuran-8-yl)ethanamine |
| SMILES | COc1c2ccoc2c(CCN)c2ccoc12 |
| InChI | InChI=1S/C13H13NO3/c1-15-12-10-4-7-16-11(10)8(2-5-14)9-3-6-17-13(9)12/h3-4,6-7H,2,5,14H2,1H3 |
| InChIKey | OCWKENDOKVTQPQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |