C15H14O2 — CID 162989540
9-methoxy-4,5-dimethylbenzo[f][1]benzofuran (PubChem CID 162989540) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 9-methoxy-4,5-dimethylbenzo[f][1]benzofuran.
| Compound Name | 9-methoxy-4,5-dimethylbenzo[f][1]benzofuran |
|---|---|
| PubChem CID | 162989540 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 9-methoxy-4,5-dimethylbenzo[f][1]benzofuran |
| SMILES | COc1c2cccc(C)c2c(C)c2ccoc12 |
| InChI | InChI=1S/C15H14O2/c1-9-5-4-6-12-13(9)10(2)11-7-8-17-15(11)14(12)16-3/h4-8H,1-3H3 |
| InChIKey | JDFOOUGTUNVBNN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |