C15H11NO4 — CID 117426059
8-(1-isocyanatocyclopropyl)-4-methoxyfuro[2,3-f][1]benzofuran (PubChem CID 117426059) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 8-(1-isocyanatocyclopropyl)-4-methoxyfuro[2,3-f][1]benzofuran.
| Compound Name | 8-(1-isocyanatocyclopropyl)-4-methoxyfuro[2,3-f][1]benzofuran |
|---|---|
| PubChem CID | 117426059 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 8-(1-isocyanatocyclopropyl)-4-methoxyfuro[2,3-f][1]benzofuran |
| SMILES | COc1c2ccoc2c(C2(N=C=O)CC2)c2ccoc12 |
| InChI | InChI=1S/C15H11NO4/c1-18-13-10-3-7-19-12(10)11(9-2-6-20-14(9)13)15(4-5-15)16-8-17/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | MUCNTYLXTYSPHJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|