C14H17NO3 — CID 117370441
4-(1-isocyanatocyclopropyl)-1,2-dimethoxy-3,5-dimethylbenzene (PubChem CID 117370441) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 4-(1-isocyanatocyclopropyl)-1,2-dimethoxy-3,5-dimethylbenzene.
| Compound Name | 4-(1-isocyanatocyclopropyl)-1,2-dimethoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 117370441 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-(1-isocyanatocyclopropyl)-1,2-dimethoxy-3,5-dimethylbenzene |
| SMILES | COc1cc(C)c(C2(N=C=O)CC2)c(C)c1OC |
| InChI | InChI=1S/C14H17NO3/c1-9-7-11(17-3)13(18-4)10(2)12(9)14(5-6-14)15-8-16/h7H,5-6H2,1-4H3 |
| InChIKey | NZSXVOOCXVIFPD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|