C15H18ClNO2 — CID 117448869
1-chloro-2-(1-isocyanatocyclopentyl)-4-methoxy-3,5-dimethylbenzene (PubChem CID 117448869) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 1-chloro-2-(1-isocyanatocyclopentyl)-4-methoxy-3,5-dimethylbenzene.
| Compound Name | 1-chloro-2-(1-isocyanatocyclopentyl)-4-methoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 117448869 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-chloro-2-(1-isocyanatocyclopentyl)-4-methoxy-3,5-dimethylbenzene |
| SMILES | COc1c(C)cc(Cl)c(C2(N=C=O)CCCC2)c1C |
| InChI | InChI=1S/C15H18ClNO2/c1-10-8-12(16)13(11(2)14(10)19-3)15(17-9-18)6-4-5-7-15/h8H,4-7H2,1-3H3 |
| InChIKey | MAEGLVRAODOQLO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|