C19H27NO2 — CID 117485718
2-(1-isocyanatocyclopentyl)-3-methoxy-1,4-di(propan-2-yl)benzene (PubChem CID 117485718) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-(1-isocyanatocyclopentyl)-3-methoxy-1,4-di(propan-2-yl)benzene.
| Compound Name | 2-(1-isocyanatocyclopentyl)-3-methoxy-1,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 117485718 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-(1-isocyanatocyclopentyl)-3-methoxy-1,4-di(propan-2-yl)benzene |
| SMILES | COc1c(C(C)C)ccc(C(C)C)c1C1(N=C=O)CCCC1 |
| InChI | InChI=1S/C19H27NO2/c1-13(2)15-8-9-16(14(3)4)18(22-5)17(15)19(20-12-21)10-6-7-11-19/h8-9,13-14H,6-7,10-11H2,1-5H3 |
| InChIKey | JWYQTWLTVXQORD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|