C14H15F2NO2 — CID 117421277
1-(difluoromethyl)-2-(1-isocyanatocyclopentyl)-4-methoxybenzene (PubChem CID 117421277) has the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-(1-isocyanatocyclopentyl)-4-methoxybenzene.
| Compound Name | 1-(difluoromethyl)-2-(1-isocyanatocyclopentyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 117421277 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-(difluoromethyl)-2-(1-isocyanatocyclopentyl)-4-methoxybenzene |
| SMILES | COc1ccc(C(F)F)c(C2(N=C=O)CCCC2)c1 |
| InChI | InChI=1S/C14H15F2NO2/c1-19-10-4-5-11(13(15)16)12(8-10)14(17-9-18)6-2-3-7-14/h4-5,8,13H,2-3,6-7H2,1H3 |
| InChIKey | SIOBAGVXTXYLHM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|