C12H10O4 — CID 11687183
4-methoxy-5-methyl-6H-furo[3,4-g][1]benzofuran-8-one (PubChem CID 11687183) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 4-methoxy-5-methyl-6H-furo[3,4-g][1]benzofuran-8-one.
| Compound Name | 4-methoxy-5-methyl-6H-furo[3,4-g][1]benzofuran-8-one |
|---|---|
| PubChem CID | 11687183 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 4-methoxy-5-methyl-6H-furo[3,4-g][1]benzofuran-8-one |
| SMILES | COc1c(C)c2c(c3occc13)C(=O)OC2 |
| InChI | InChI=1S/C12H10O4/c1-6-8-5-16-12(13)9(8)11-7(3-4-15-11)10(6)14-2/h3-4H,5H2,1-2H3 |
| InChIKey | PWVJUFRLWBDUCL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |