C12H19ClFNO — CID 171257323
2-[(1R)-1-amino-2,2-dimethylpropyl]-3-fluoro-6-methylphenol;hydrochloride (PubChem CID 171257323) has the molecular formula C12H19ClFNO and a molecular weight of 247.74 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-dimethylpropyl]-3-fluoro-6-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2-dimethylpropyl]-3-fluoro-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171257323 |
| Molecular Formula | C12H19ClFNO |
| Molecular Weight | 247.74 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-dimethylpropyl]-3-fluoro-6-methylphenol;hydrochloride |
| SMILES | Cc1ccc(F)c([C@H](N)C(C)(C)C)c1O.Cl |
| InChI | InChI=1S/C12H18FNO.ClH/c1-7-5-6-8(13)9(10(7)15)11(14)12(2,3)4;/h5-6,11,15H,14H2,1-4H3;1H/t11-;/m0./s1 |
| InChIKey | MSJRVSFUYRLEGI-MERQFXBCSA-N |
| XLogP | 3.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|