C10H14FNO2 — CID 84668827
2-(1-amino-3-hydroxypropyl)-3-fluoro-6-methylphenol (PubChem CID 84668827) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is 2-(1-amino-3-hydroxypropyl)-3-fluoro-6-methylphenol.
| Compound Name | 2-(1-amino-3-hydroxypropyl)-3-fluoro-6-methylphenol |
|---|---|
| PubChem CID | 84668827 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-(1-amino-3-hydroxypropyl)-3-fluoro-6-methylphenol |
| SMILES | Cc1ccc(F)c(C(N)CCO)c1O |
| InChI | InChI=1S/C10H14FNO2/c1-6-2-3-7(11)9(10(6)14)8(12)4-5-13/h2-3,8,13-14H,4-5,12H2,1H3 |
| InChIKey | VWKSZGZZEPWWPK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|