C9H11ClF3NO — CID 171253959
2-[(1R)-1-amino-2,2-difluoroethyl]-3-fluoro-6-methylphenol;hydrochloride (PubChem CID 171253959) has the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoroethyl]-3-fluoro-6-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-3-fluoro-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171253959 |
| Molecular Formula | C9H11ClF3NO |
| Molecular Weight | 241.64 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-3-fluoro-6-methylphenol;hydrochloride |
| SMILES | Cc1ccc(F)c([C@@H](N)C(F)F)c1O.Cl |
| InChI | InChI=1S/C9H10F3NO.ClH/c1-4-2-3-5(10)6(8(4)14)7(13)9(11)12;/h2-3,7,9,14H,13H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | JUKILGMBJVYHHO-OGFXRTJISA-N |
| XLogP | 2.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.64 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|