C22H32Cl2MnN3- — CID 66808819
bis[2-amino-2-(2,4,6-trimethylphenyl)ethyl]azanide;dichloromanganese (PubChem CID 66808819) has the molecular formula C22H32Cl2MnN3- and a molecular weight of 464.36 g/mol. Its IUPAC name is bis[2-amino-2-(2,4,6-trimethylphenyl)ethyl]azanide;dichloromanganese.
| Compound Name | bis[2-amino-2-(2,4,6-trimethylphenyl)ethyl]azanide;dichloromanganese |
|---|---|
| PubChem CID | 66808819 |
| Molecular Formula | C22H32Cl2MnN3- |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | bis[2-amino-2-(2,4,6-trimethylphenyl)ethyl]azanide;dichloromanganese |
| SMILES | Cc1cc(C)c(C(N)C[N-]CC(N)c2c(C)cc(C)cc2C)c(C)c1.Cl[Mn]Cl |
| InChI | InChI=1S/C22H32N3.2ClH.Mn/c1-13-7-15(3)21(16(4)8-13)19(23)11-25-12-20(24)22-17(5)9-14(2)10-18(22)6;;;/h7-10,19-20H,11-12,23-24H2,1-6H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | XASUWSNFIQEUJP-UHFFFAOYSA-L |
| XLogP | 5.99 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |