C20H28CoN3- — CID 66809098
bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;cobalt (PubChem CID 66809098) has the molecular formula C20H28CoN3- and a molecular weight of 369.40 g/mol. Its IUPAC name is bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;cobalt.
| Compound Name | bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;cobalt |
|---|---|
| PubChem CID | 66809098 |
| Molecular Formula | C20H28CoN3- |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;cobalt |
| SMILES | Cc1cccc(C)c1C(N)C[N-]CC(N)c1c(C)cccc1C.[Co] |
| InChI | InChI=1S/C20H28N3.Co/c1-13-7-5-8-14(2)19(13)17(21)11-23-12-18(22)20-15(3)9-6-10-16(20)4;/h5-10,17-18H,11-12,21-22H2,1-4H3;/q-1; |
| InChIKey | VIUBAIMKYYDKNZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |