C11H14F2N2 — CID 65380173
1-(2,6-difluorophenyl)-N-prop-2-enylethane-1,2-diamine (PubChem CID 65380173) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-prop-2-enylethane-1,2-diamine.
| Compound Name | 1-(2,6-difluorophenyl)-N-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 65380173 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCNC(CN)c1c(F)cccc1F |
| InChI | InChI=1S/C11H14F2N2/c1-2-6-15-10(7-14)11-8(12)4-3-5-9(11)13/h2-5,10,15H,1,6-7,14H2 |
| InChIKey | ORGRDDDKVXYOCV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|