About 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol
5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol (PubChem CID 107317087) has the molecular formula C13H20F2N2O
and a molecular weight of 258.31 g/mol. Its IUPAC name is 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol.
Molecular Properties
| Compound Name | 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol |
| PubChem CID | 107317087 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol |
| SMILES | NCC(NCCCCCO)c1c(F)cccc1F |
| InChI | InChI=1S/C13H20F2N2O/c14-10-5-4-6-11(15)13(10)12(9-16)17-7-2-1-3-8-18/h4-6,12,17-18H,1-3,7-9,16H2 |
| InChIKey | NXMBKCXICOUXKV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol?
The IUPAC name of 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol (CID 107317087) is 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol.
What is the SMILES notation for 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol?
The canonical SMILES for 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol is NCC(NCCCCCO)c1c(F)cccc1F.
What is the InChIKey of 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol?
The InChIKey is NXMBKCXICOUXKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2O/c14-10-5-4-6-11(15)13(10)12(9-16)17-7-2-1-3-8-18/h4-6,12,17-18H,1-3,7-9,16H2.
What are the key properties of 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol?
5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol has a molecular weight of 258.31 g/mol, XLogP of 1.72, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-amino-1-(2,6-difluorophenyl)ethyl]amino]pentan-1-ol is sourced from PubChem (CID 107317087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).