C15H26N2O2 — CID 107316874
5-[[2-amino-1-[2-(methoxymethyl)phenyl]ethyl]amino]pentan-1-ol (PubChem CID 107316874) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 5-[[2-amino-1-[2-(methoxymethyl)phenyl]ethyl]amino]pentan-1-ol.
| Compound Name | 5-[[2-amino-1-[2-(methoxymethyl)phenyl]ethyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107316874 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 5-[[2-amino-1-[2-(methoxymethyl)phenyl]ethyl]amino]pentan-1-ol |
| SMILES | COCc1ccccc1C(CN)NCCCCCO |
| InChI | InChI=1S/C15H26N2O2/c1-19-12-13-7-3-4-8-14(13)15(11-16)17-9-5-2-6-10-18/h3-4,7-8,15,17-18H,2,5-6,9-12,16H2,1H3 |
| InChIKey | AHRBWFDQJWIULJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|