C12H17F3N2O — CID 65378871
3-[[2-amino-1-[2-(trifluoromethyl)phenyl]ethyl]amino]propan-1-ol (PubChem CID 65378871) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-[[2-amino-1-[2-(trifluoromethyl)phenyl]ethyl]amino]propan-1-ol.
| Compound Name | 3-[[2-amino-1-[2-(trifluoromethyl)phenyl]ethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 65378871 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[[2-amino-1-[2-(trifluoromethyl)phenyl]ethyl]amino]propan-1-ol |
| SMILES | NCC(NCCCO)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O/c13-12(14,15)10-5-2-1-4-9(10)11(8-16)17-6-3-7-18/h1-2,4-5,11,17-18H,3,6-8,16H2 |
| InChIKey | NDEJBQMIBAUGRY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|