C15H21F3N2 — CID 65384743
N-cyclohexyl-1-[2-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 65384743) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is N-cyclohexyl-1-[2-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N-cyclohexyl-1-[2-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 65384743 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-cyclohexyl-1-[2-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | NCC(NC1CCCCC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2/c16-15(17,18)13-9-5-4-8-12(13)14(10-19)20-11-6-2-1-3-7-11/h4-5,8-9,11,14,20H,1-3,6-7,10,19H2 |
| InChIKey | IQEJSNRSBLYMRO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |