C8H6Cl4F3N — CID 171243893
(1R)-2,2,2-trifluoro-1-(2,3,6-trichlorophenyl)ethanamine;hydrochloride (PubChem CID 171243893) has the molecular formula C8H6Cl4F3N and a molecular weight of 314.95 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(2,3,6-trichlorophenyl)ethanamine;hydrochloride.
| Compound Name | (1R)-2,2,2-trifluoro-1-(2,3,6-trichlorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171243893 |
| Molecular Formula | C8H6Cl4F3N |
| Molecular Weight | 314.95 g/mol |
| Exact Mass | 312.92 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(2,3,6-trichlorophenyl)ethanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1c(Cl)ccc(Cl)c1Cl)C(F)(F)F |
| InChI | InChI=1S/C8H5Cl3F3N.ClH/c9-3-1-2-4(10)6(11)5(3)7(15)8(12,13)14;/h1-2,7H,15H2;1H/t7-;/m1./s1 |
| InChIKey | NWWBDTKIWDZOOH-OGFXRTJISA-N |
| XLogP | 4.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.95 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|