C13H13F2NO2 — CID 171250512
1-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]naphthalen-2-ol (PubChem CID 171250512) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 1-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]naphthalen-2-ol.
| Compound Name | 1-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 171250512 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]naphthalen-2-ol |
| SMILES | N[C@@H](c1c(O)ccc2ccccc12)C(F)(F)CO |
| InChI | InChI=1S/C13H13F2NO2/c14-13(15,7-17)12(16)11-9-4-2-1-3-8(9)5-6-10(11)18/h1-6,12,17-18H,7,16H2/t12-/m0/s1 |
| InChIKey | RQQOLHSQSJRFJJ-LBPRGKRZSA-N |
| XLogP | 2.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|