C11H15Cl3FN — CID 171215588
(1R)-1-(2,3-dichloro-6-fluorophenyl)-3-methylbutan-1-amine;hydrochloride (PubChem CID 171215588) has the molecular formula C11H15Cl3FN and a molecular weight of 286.61 g/mol. Its IUPAC name is (1R)-1-(2,3-dichloro-6-fluorophenyl)-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2,3-dichloro-6-fluorophenyl)-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171215588 |
| Molecular Formula | C11H15Cl3FN |
| Molecular Weight | 286.61 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | (1R)-1-(2,3-dichloro-6-fluorophenyl)-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)C[C@@H](N)c1c(F)ccc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C11H14Cl2FN.ClH/c1-6(2)5-9(15)10-8(14)4-3-7(12)11(10)13;/h3-4,6,9H,5,15H2,1-2H3;1H/t9-;/m1./s1 |
| InChIKey | QJGVRNSIVPPXGV-SBSPUUFOSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|