C12H18Cl2FN — CID 171209149
(1R)-1-(6-chloro-2-fluoro-3-methylphenyl)-3-methylbutan-1-amine;hydrochloride (PubChem CID 171209149) has the molecular formula C12H18Cl2FN and a molecular weight of 266.19 g/mol. Its IUPAC name is (1R)-1-(6-chloro-2-fluoro-3-methylphenyl)-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(6-chloro-2-fluoro-3-methylphenyl)-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171209149 |
| Molecular Formula | C12H18Cl2FN |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | (1R)-1-(6-chloro-2-fluoro-3-methylphenyl)-3-methylbutan-1-amine;hydrochloride |
| SMILES | Cc1ccc(Cl)c([C@H](N)CC(C)C)c1F.Cl |
| InChI | InChI=1S/C12H17ClFN.ClH/c1-7(2)6-10(15)11-9(13)5-4-8(3)12(11)14;/h4-5,7,10H,6,15H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | YKNAWYVCJZNFKT-HNCPQSOCSA-N |
| XLogP | 4.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |