C11H15Cl2F2N — CID 171208998
(1R)-1-(3-chloro-2,6-difluorophenyl)-3-methylbutan-1-amine;hydrochloride (PubChem CID 171208998) has the molecular formula C11H15Cl2F2N and a molecular weight of 270.15 g/mol. Its IUPAC name is (1R)-1-(3-chloro-2,6-difluorophenyl)-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(3-chloro-2,6-difluorophenyl)-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171208998 |
| Molecular Formula | C11H15Cl2F2N |
| Molecular Weight | 270.15 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (1R)-1-(3-chloro-2,6-difluorophenyl)-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)C[C@@H](N)c1c(F)ccc(Cl)c1F.Cl |
| InChI | InChI=1S/C11H14ClF2N.ClH/c1-6(2)5-9(15)10-8(13)4-3-7(12)11(10)14;/h3-4,6,9H,5,15H2,1-2H3;1H/t9-;/m1./s1 |
| InChIKey | PZPZTUDMBVZUEI-SBSPUUFOSA-N |
| XLogP | 4.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.15 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|