C14H18ClF2N — CID 114275390
(6-chloro-2,3-difluorophenyl)-(2,2,3,3-tetramethylcyclopropyl)methanamine (PubChem CID 114275390) has the molecular formula C14H18ClF2N and a molecular weight of 273.75 g/mol. Its IUPAC name is (6-chloro-2,3-difluorophenyl)-(2,2,3,3-tetramethylcyclopropyl)methanamine.
| Compound Name | (6-chloro-2,3-difluorophenyl)-(2,2,3,3-tetramethylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 114275390 |
| Molecular Formula | C14H18ClF2N |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (6-chloro-2,3-difluorophenyl)-(2,2,3,3-tetramethylcyclopropyl)methanamine |
| SMILES | CC1(C)C(C(N)c2c(Cl)ccc(F)c2F)C1(C)C |
| InChI | InChI=1S/C14H18ClF2N/c1-13(2)12(14(13,3)4)11(18)9-7(15)5-6-8(16)10(9)17/h5-6,11-12H,18H2,1-4H3 |
| InChIKey | DVZCBYBAJQAGMC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|