C11H16ClN — CID 82758328
(1S)-1-(4-chloro-2,5-dimethylphenyl)propan-1-amine (PubChem CID 82758328) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is (1S)-1-(4-chloro-2,5-dimethylphenyl)propan-1-amine.
| Compound Name | (1S)-1-(4-chloro-2,5-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 82758328 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (1S)-1-(4-chloro-2,5-dimethylphenyl)propan-1-amine |
| SMILES | CC[C@H](N)c1cc(C)c(Cl)cc1C |
| InChI | InChI=1S/C11H16ClN/c1-4-11(13)9-5-8(3)10(12)6-7(9)2/h5-6,11H,4,13H2,1-3H3/t11-/m0/s1 |
| InChIKey | PXIUUNHKOZUOGG-NSHDSACASA-N |
| XLogP | 3.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |