C11H16FN — CID 131007811
1-(4-fluoro-2,5-dimethylphenyl)propan-1-amine (PubChem CID 131007811) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 1-(4-fluoro-2,5-dimethylphenyl)propan-1-amine.
| Compound Name | 1-(4-fluoro-2,5-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 131007811 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-(4-fluoro-2,5-dimethylphenyl)propan-1-amine |
| SMILES | CCC(N)c1cc(C)c(F)cc1C |
| InChI | InChI=1S/C11H16FN/c1-4-11(13)9-5-8(3)10(12)6-7(9)2/h5-6,11H,4,13H2,1-3H3 |
| InChIKey | OPBGXVZKFNCXMC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |