C10H13Cl2NO — CID 131011081
(3S)-3-amino-3-(4,5-dichloro-2-methylphenyl)propan-1-ol (PubChem CID 131011081) has the molecular formula C10H13Cl2NO and a molecular weight of 234.13 g/mol. Its IUPAC name is (3S)-3-amino-3-(4,5-dichloro-2-methylphenyl)propan-1-ol.
| Compound Name | (3S)-3-amino-3-(4,5-dichloro-2-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 131011081 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | (3S)-3-amino-3-(4,5-dichloro-2-methylphenyl)propan-1-ol |
| SMILES | Cc1cc(Cl)c(Cl)cc1[C@@H](N)CCO |
| InChI | InChI=1S/C10H13Cl2NO/c1-6-4-8(11)9(12)5-7(6)10(13)2-3-14/h4-5,10,14H,2-3,13H2,1H3/t10-/m0/s1 |
| InChIKey | IUOKOAJAWASPJT-JTQLQIEISA-N |
| XLogP | 2.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |