C14H20N2 — CID 101095411
(2S)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]butanenitrile (PubChem CID 101095411) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]butanenitrile.
| Compound Name | (2S)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]butanenitrile |
|---|---|
| PubChem CID | 101095411 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]butanenitrile |
| SMILES | C[C@@H](N[C@H](C#N)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H20N2/c1-11(12-8-6-5-7-9-12)16-13(10-15)14(2,3)4/h5-9,11,13,16H,1-4H3/t11-,13-/m1/s1 |
| InChIKey | GTKIFEDYSFURFE-DGCLKSJQSA-N |
| XLogP | 3.28 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |