C16H24N2 — CID 167570307
(2S,3S,4S)-3,4-dimethyl-2-[[(1S)-1-phenylethyl]amino]hexanenitrile (PubChem CID 167570307) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (2S,3S,4S)-3,4-dimethyl-2-[[(1S)-1-phenylethyl]amino]hexanenitrile.
| Compound Name | (2S,3S,4S)-3,4-dimethyl-2-[[(1S)-1-phenylethyl]amino]hexanenitrile |
|---|---|
| PubChem CID | 167570307 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (2S,3S,4S)-3,4-dimethyl-2-[[(1S)-1-phenylethyl]amino]hexanenitrile |
| SMILES | CC[C@H](C)[C@H](C)[C@@H](C#N)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H24N2/c1-5-12(2)13(3)16(11-17)18-14(4)15-9-7-6-8-10-15/h6-10,12-14,16,18H,5H2,1-4H3/t12-,13-,14-,16+/m0/s1 |
| InChIKey | XXAMLRNRXYTYMW-RZLSGREXSA-N |
| XLogP | 3.91 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |