C12H20N2 — CID 103389165
2-N-[1-(4-methylphenyl)ethyl]propane-1,2-diamine (PubChem CID 103389165) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-N-[1-(4-methylphenyl)ethyl]propane-1,2-diamine.
| Compound Name | 2-N-[1-(4-methylphenyl)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 103389165 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-N-[1-(4-methylphenyl)ethyl]propane-1,2-diamine |
| SMILES | Cc1ccc(C(C)NC(C)CN)cc1 |
| InChI | InChI=1S/C12H20N2/c1-9-4-6-12(7-5-9)11(3)14-10(2)8-13/h4-7,10-11,14H,8,13H2,1-3H3 |
| InChIKey | SVILCEGHHBHQCG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |