C30H39BF3NO3 — CID 173097114
hydroxy-[1,1,2-tris(3-fluorophenyl)butoxy]borinate;tetraethylazanium (PubChem CID 173097114) has the molecular formula C30H39BF3NO3 and a molecular weight of 529.45 g/mol. Its IUPAC name is hydroxy-[1,1,2-tris(3-fluorophenyl)butoxy]borinate;tetraethylazanium.
| Compound Name | hydroxy-[1,1,2-tris(3-fluorophenyl)butoxy]borinate;tetraethylazanium |
|---|---|
| PubChem CID | 173097114 |
| Molecular Formula | C30H39BF3NO3 |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | hydroxy-[1,1,2-tris(3-fluorophenyl)butoxy]borinate;tetraethylazanium |
| SMILES | CCC(c1cccc(F)c1)C(OB([O-])O)(c1cccc(F)c1)c1cccc(F)c1.CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C22H19BF3O3.C8H20N/c1-2-21(15-6-3-9-18(24)12-15)22(29-23(27)28,16-7-4-10-19(25)13-16)17-8-5-11-20(26)14-17;1-5-9(6-2,7-3)8-4/h3-14,21,27H,2H2,1H3;5-8H2,1-4H3/q-1;+1 |
| InChIKey | NTBANLALPLBOCV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|