C78H51BF12O3 — CID 56999884
tris[1,2,2,2-tetrakis(3-fluorophenyl)ethyl] borate (PubChem CID 56999884) has the molecular formula C78H51BF12O3 and a molecular weight of 1275.05 g/mol. Its IUPAC name is tris[1,2,2,2-tetrakis(3-fluorophenyl)ethyl] borate.
| Compound Name | tris[1,2,2,2-tetrakis(3-fluorophenyl)ethyl] borate |
|---|---|
| PubChem CID | 56999884 |
| Molecular Formula | C78H51BF12O3 |
| Molecular Weight | 1275.05 g/mol |
| Exact Mass | 1274.37 |
| IUPAC Name | tris[1,2,2,2-tetrakis(3-fluorophenyl)ethyl] borate |
| SMILES | Fc1cccc(C(OB(OC(c2cccc(F)c2)C(c2cccc(F)c2)(c2cccc(F)c2)c2cccc(F)c2)OC(c2cccc(F)c2)C(c2cccc(F)c2)(c2cccc(F)c2)c2cccc(F)c2)C(c2cccc(F)c2)(c2cccc(F)c2)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C78H51BF12O3/c80-61-25-1-13-49(37-61)73(76(52-16-4-28-64(83)40-52,53-17-5-29-65(84)41-53)54-18-6-30-66(85)42-54)92-79(93-74(50-14-2-26-62(81)38-50)77(55-19-7-31-67(86)43-55,56-20-8-32-68(87)44-56)57-21-9-33-69(88)45-57)94-75(51-15-3-27-63(82)39-51)78(58-22-10-34-70(89)46-58,59-23-11-35-71(90)47-59)60-24-12-36-72(91)48-60/h1-48,73-75H |
| InChIKey | MRCLLYBHNMLDBV-UHFFFAOYSA-N |
| XLogP | 20.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1275.05 |
| LogP ≤ 5 | 20.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|