C26H35F3O2 — CID 151504192
2-[4-(3,3-dimethoxydodecan-4-yl)phenyl]-1,3,5-trifluorobenzene (PubChem CID 151504192) has the molecular formula C26H35F3O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[4-(3,3-dimethoxydodecan-4-yl)phenyl]-1,3,5-trifluorobenzene.
| Compound Name | 2-[4-(3,3-dimethoxydodecan-4-yl)phenyl]-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 151504192 |
| Molecular Formula | C26H35F3O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 2-[4-(3,3-dimethoxydodecan-4-yl)phenyl]-1,3,5-trifluorobenzene |
| SMILES | CCCCCCCCC(c1ccc(-c2c(F)cc(F)cc2F)cc1)C(CC)(OC)OC |
| InChI | InChI=1S/C26H35F3O2/c1-5-7-8-9-10-11-12-22(26(6-2,30-3)31-4)19-13-15-20(16-14-19)25-23(28)17-21(27)18-24(25)29/h13-18,22H,5-12H2,1-4H3 |
| InChIKey | PRBMUYLIQPFAAL-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|