C27H45F3O — CID 151687437
2-methyl-3-propan-2-yl-4-[5-(2,4,5-trifluorophenyl)pentyl]dodecan-3-ol (PubChem CID 151687437) has the molecular formula C27H45F3O and a molecular weight of 442.65 g/mol. Its IUPAC name is 2-methyl-3-propan-2-yl-4-[5-(2,4,5-trifluorophenyl)pentyl]dodecan-3-ol.
| Compound Name | 2-methyl-3-propan-2-yl-4-[5-(2,4,5-trifluorophenyl)pentyl]dodecan-3-ol |
|---|---|
| PubChem CID | 151687437 |
| Molecular Formula | C27H45F3O |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 2-methyl-3-propan-2-yl-4-[5-(2,4,5-trifluorophenyl)pentyl]dodecan-3-ol |
| SMILES | CCCCCCCCC(CCCCCc1cc(F)c(F)cc1F)C(O)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H45F3O/c1-6-7-8-9-10-13-16-23(27(31,20(2)3)21(4)5)17-14-11-12-15-22-18-25(29)26(30)19-24(22)28/h18-21,23,31H,6-17H2,1-5H3 |
| InChIKey | RBVKUKMUNBDHOQ-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|