C11H15BF2O2 — CID 54088623
(2,5-difluoro-4-pentylphenyl)boronic acid (PubChem CID 54088623) has the molecular formula C11H15BF2O2 and a molecular weight of 228.05 g/mol. Its IUPAC name is (2,5-difluoro-4-pentylphenyl)boronic acid.
| Compound Name | (2,5-difluoro-4-pentylphenyl)boronic acid |
|---|---|
| PubChem CID | 54088623 |
| Molecular Formula | C11H15BF2O2 |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2,5-difluoro-4-pentylphenyl)boronic acid |
| SMILES | CCCCCc1cc(F)c(B(O)O)cc1F |
| InChI | InChI=1S/C11H15BF2O2/c1-2-3-4-5-8-6-11(14)9(12(15)16)7-10(8)13/h6-7,15-16H,2-5H2,1H3 |
| InChIKey | MSGVLQDGYGHCPG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|