C13H16F4O — CID 58719084
1-[difluoro(methoxy)methyl]-2,5-difluoro-4-pentylbenzene (PubChem CID 58719084) has the molecular formula C13H16F4O and a molecular weight of 264.26 g/mol. Its IUPAC name is 1-[difluoro(methoxy)methyl]-2,5-difluoro-4-pentylbenzene.
| Compound Name | 1-[difluoro(methoxy)methyl]-2,5-difluoro-4-pentylbenzene |
|---|---|
| PubChem CID | 58719084 |
| Molecular Formula | C13H16F4O |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[difluoro(methoxy)methyl]-2,5-difluoro-4-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(C(F)(F)OC)cc1F |
| InChI | InChI=1S/C13H16F4O/c1-3-4-5-6-9-7-12(15)10(8-11(9)14)13(16,17)18-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | DULGQIFZDXGCMA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|