C10H13F2N — CID 107616102
4-butyl-2,5-difluoroaniline (PubChem CID 107616102) has the molecular formula C10H13F2N and a molecular weight of 185.22 g/mol. Its IUPAC name is 4-butyl-2,5-difluoroaniline.
| Compound Name | 4-butyl-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107616102 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4-butyl-2,5-difluoroaniline |
| SMILES | CCCCc1cc(F)c(N)cc1F |
| InChI | InChI=1S/C10H13F2N/c1-2-3-4-7-5-9(12)10(13)6-8(7)11/h5-6H,2-4,13H2,1H3 |
| InChIKey | ONLPSLRXUGVWMT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|