C14H25Br2F3 — CID 151761028
4-(1,1-dibromoethyl)-1,1,1-trifluorododecane (PubChem CID 151761028) has the molecular formula C14H25Br2F3 and a molecular weight of 410.16 g/mol. Its IUPAC name is 4-(1,1-dibromoethyl)-1,1,1-trifluorododecane.
| Compound Name | 4-(1,1-dibromoethyl)-1,1,1-trifluorododecane |
|---|---|
| PubChem CID | 151761028 |
| Molecular Formula | C14H25Br2F3 |
| Molecular Weight | 410.16 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 4-(1,1-dibromoethyl)-1,1,1-trifluorododecane |
| SMILES | CCCCCCCCC(CCC(F)(F)F)C(C)(Br)Br |
| InChI | InChI=1S/C14H25Br2F3/c1-3-4-5-6-7-8-9-12(13(2,15)16)10-11-14(17,18)19/h12H,3-11H2,1-2H3 |
| InChIKey | RQOGCVYGILVTGY-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.16 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|