C32H66O — CID 175472174
5-[3-(4-butyl-2,3,3-trimethylnonan-2-yl)oxy-2,3-dimethylbutan-2-yl]decane (PubChem CID 175472174) has the molecular formula C32H66O and a molecular weight of 466.88 g/mol. Its IUPAC name is 5-[3-(4-butyl-2,3,3-trimethylnonan-2-yl)oxy-2,3-dimethylbutan-2-yl]decane.
| Compound Name | 5-[3-(4-butyl-2,3,3-trimethylnonan-2-yl)oxy-2,3-dimethylbutan-2-yl]decane |
|---|---|
| PubChem CID | 175472174 |
| Molecular Formula | C32H66O |
| Molecular Weight | 466.88 g/mol |
| Exact Mass | 466.51 |
| IUPAC Name | 5-[3-(4-butyl-2,3,3-trimethylnonan-2-yl)oxy-2,3-dimethylbutan-2-yl]decane |
| SMILES | CCCCCC(CCCC)C(C)(C)C(C)(C)OC(C)(C)C(C)(C)C(CCCC)CCCCC |
| InChI | InChI=1S/C32H66O/c1-13-17-21-25-27(23-19-15-3)29(5,6)31(9,10)33-32(11,12)30(7,8)28(24-20-16-4)26-22-18-14-2/h27-28H,13-26H2,1-12H3 |
| InChIKey | YAUGKTACEMDRSF-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.88 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|