C28H40F3IO3S — CID 159878337
bis(4-tert-butylphenyl)iodanium;8,8,8-trifluorooctane-1-sulfonate (PubChem CID 159878337) has the molecular formula C28H40F3IO3S and a molecular weight of 640.59 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)iodanium;8,8,8-trifluorooctane-1-sulfonate.
| Compound Name | bis(4-tert-butylphenyl)iodanium;8,8,8-trifluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 159878337 |
| Molecular Formula | C28H40F3IO3S |
| Molecular Weight | 640.59 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | bis(4-tert-butylphenyl)iodanium;8,8,8-trifluorooctane-1-sulfonate |
| SMILES | CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.O=S(=O)([O-])CCCCCCCC(F)(F)F |
| InChI | InChI=1S/C20H26I.C8H15F3O3S/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;9-8(10,11)6-4-2-1-3-5-7-15(12,13)14/h7-14H,1-6H3;1-7H2,(H,12,13,14)/q+1;/p-1 |
| InChIKey | NTEXTKCBRDZMID-UHFFFAOYSA-M |
| XLogP | 4.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|