C41H52F2I2O6S2 — CID 159627651
bis(bis(4-tert-butylphenyl)iodanium);difluoro(oxidoperoxysulfanyl)methanesulfonate (PubChem CID 159627651) has the molecular formula C41H52F2I2O6S2 and a molecular weight of 996.80 g/mol. Its IUPAC name is bis(bis(4-tert-butylphenyl)iodanium);difluoro(oxidoperoxysulfanyl)methanesulfonate.
| Compound Name | bis(bis(4-tert-butylphenyl)iodanium);difluoro(oxidoperoxysulfanyl)methanesulfonate |
|---|---|
| PubChem CID | 159627651 |
| Molecular Formula | C41H52F2I2O6S2 |
| Molecular Weight | 996.80 g/mol |
| Exact Mass | 996.13 |
| IUPAC Name | bis(bis(4-tert-butylphenyl)iodanium);difluoro(oxidoperoxysulfanyl)methanesulfonate |
| SMILES | CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.O=S(=O)([O-])C(F)(F)SOO[O-] |
| InChI | InChI=1S/2C20H26I.CH2F2O6S2/c2*1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;2-1(3,10-9-8-4)11(5,6)7/h2*7-14H,1-6H3;4H,(H,5,6,7)/q2*+1;/p-2 |
| InChIKey | MOSBHJFFRVUEGL-UHFFFAOYSA-L |
| XLogP | 3.77 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|