C18H36F3O2P — CID 87558348
tetrabutylphosphanium;2,2,2-trifluoroacetate (PubChem CID 87558348) has the molecular formula C18H36F3O2P and a molecular weight of 372.45 g/mol. Its IUPAC name is tetrabutylphosphanium;2,2,2-trifluoroacetate.
| Compound Name | tetrabutylphosphanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87558348 |
| Molecular Formula | C18H36F3O2P |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | tetrabutylphosphanium;2,2,2-trifluoroacetate |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C16H36P.C2HF3O2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;3-2(4,5)1(6)7/h5-16H2,1-4H3;(H,6,7)/q+1;/p-1 |
| InChIKey | TXMIUMUSEKVUBH-UHFFFAOYSA-M |
| XLogP | 5.50 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|