C10H19KO2 — CID 175224943
potassium 2,2,3-trimethylheptanoate (PubChem CID 175224943) has the molecular formula C10H19KO2 and a molecular weight of 210.36 g/mol. Its IUPAC name is potassium 2,2,3-trimethylheptanoate.
| Compound Name | potassium 2,2,3-trimethylheptanoate |
|---|---|
| PubChem CID | 175224943 |
| Molecular Formula | C10H19KO2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | potassium 2,2,3-trimethylheptanoate |
| SMILES | CCCCC(C)C(C)(C)C(=O)[O-].[K+] |
| InChI | InChI=1S/C10H20O2.K/c1-5-6-7-8(2)10(3,4)9(11)12;/h8H,5-7H2,1-4H3,(H,11,12);/q;+1/p-1 |
| InChIKey | ZVNUMFOVBDQYEF-UHFFFAOYSA-M |
| XLogP | -1.41 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |