About propanedioic acid;tetrabutylphosphanium
propanedioic acid;tetrabutylphosphanium (PubChem CID 87768954) has the molecular formula C19H40O4P+
and a molecular weight of 363.50 g/mol. Its IUPAC name is propanedioic acid;tetrabutylphosphanium.
Molecular Properties
| Compound Name | propanedioic acid;tetrabutylphosphanium |
| PubChem CID | 87768954 |
| Molecular Formula | C19H40O4P+ |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | propanedioic acid;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.O=C(O)CC(=O)O |
| InChI | InChI=1S/C16H36P.C3H4O4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;4-2(5)1-3(6)7/h5-16H2,1-4H3;1H2,(H,4,5)(H,6,7)/q+1; |
| InChIKey | YTZCALRIUFUBIL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propanedioic acid;tetrabutylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanedioic acid;tetrabutylphosphanium?
The IUPAC name of propanedioic acid;tetrabutylphosphanium (CID 87768954) is propanedioic acid;tetrabutylphosphanium.
What is the SMILES notation for propanedioic acid;tetrabutylphosphanium?
The canonical SMILES for propanedioic acid;tetrabutylphosphanium is CCCC[P+](CCCC)(CCCC)CCCC.O=C(O)CC(=O)O.
What is the InChIKey of propanedioic acid;tetrabutylphosphanium?
The InChIKey is YTZCALRIUFUBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36P.C3H4O4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;4-2(5)1-3(6)7/h5-16H2,1-4H3;1H2,(H,4,5)(H,6,7)/q+1;.
What are the key properties of propanedioic acid;tetrabutylphosphanium?
propanedioic acid;tetrabutylphosphanium has a molecular weight of 363.50 g/mol, XLogP of 5.75, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanedioic acid;tetrabutylphosphanium is sourced from PubChem (CID 87768954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).