C7H4F9NaO2 — CID 139946957
sodium 2,2,3,3,4,4,7,7,7-nonafluoroheptanoate (PubChem CID 139946957) has the molecular formula C7H4F9NaO2 and a molecular weight of 314.08 g/mol. Its IUPAC name is sodium 2,2,3,3,4,4,7,7,7-nonafluoroheptanoate.
| Compound Name | sodium 2,2,3,3,4,4,7,7,7-nonafluoroheptanoate |
|---|---|
| PubChem CID | 139946957 |
| Molecular Formula | C7H4F9NaO2 |
| Molecular Weight | 314.08 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | sodium 2,2,3,3,4,4,7,7,7-nonafluoroheptanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F.[Na+] |
| InChI | InChI=1S/C7H5F9O2.Na/c8-4(9,1-2-5(10,11)12)7(15,16)6(13,14)3(17)18;/h1-2H2,(H,17,18);/q;+1/p-1 |
| InChIKey | FOGKHEBCGUKQQT-UHFFFAOYSA-M |
| XLogP | -1.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.08 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|