C27F51N3O6 — CID 12568339
2,4,6-tris[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3,5-triazine (PubChem CID 12568339) has the molecular formula C27F51N3O6 and a molecular weight of 1431.21 g/mol. Its IUPAC name is 2,4,6-tris[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 12568339 |
| Molecular Formula | C27F51N3O6 |
| Molecular Weight | 1431.21 g/mol |
| Exact Mass | 1430.90 |
| IUPAC Name | 2,4,6-tris[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3,5-triazine |
| SMILES | FC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1nc(C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)nc(C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C27F51N3O6/c28-4(13(40,41)42,82-25(73,74)10(37,19(58,59)60)85-22(67,68)7(31,32)16(49,50)51)1-79-2(5(29,14(43,44)45)83-26(75,76)11(38,20(61,62)63)86-23(69,70)8(33,34)17(52,53)54)81-3(80-1)6(30,15(46,47)48)84-27(77,78)12(39,21(64,65)66)87-24(71,72)9(35,36)18(55,56)57 |
| InChIKey | RPXSHSGOEDLBKR-UHFFFAOYSA-N |
| XLogP | 15.86 |
| TPSA | 94.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1431.21 |
| LogP ≤ 5 | 15.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|